C22H31BrO2 — CID 165360209
(6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-bromo-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 165360209) has the molecular formula C22H31BrO2 and a molecular weight of 407.39 g/mol. Its IUPAC name is (6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-bromo-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-bromo-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 165360209 |
| Molecular Formula | C22H31BrO2 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-bromo-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(Br)CC[C@H]2[C@@H]3C[C@H](C)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H31BrO2/c1-13-11-16-17(20(3)8-5-15(25)12-19(13)20)6-9-21(4)18(16)7-10-22(21,23)14(2)24/h12-13,16-18H,5-11H2,1-4H3/t13-,16+,17-,18-,20+,21-,22-/m0/s1 |
| InChIKey | IMDRZPLSTNEVLC-HBNHAYAOSA-N |
| XLogP | 5.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|