C24H36O5 — CID 87996239
(6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-(1,1-dihydroxyethoxy)-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 87996239) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-(1,1-dihydroxyethoxy)-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-(1,1-dihydroxyethoxy)-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 87996239 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-(1,1-dihydroxyethoxy)-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(OC(C)(O)O)CC[C@H]2[C@@H]3C[C@H](C)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H36O5/c1-14-12-17-18(21(3)9-6-16(26)13-20(14)21)7-10-22(4)19(17)8-11-24(22,15(2)25)29-23(5,27)28/h13-14,17-19,27-28H,6-12H2,1-5H3/t14-,17+,18-,19-,21+,22-,24-/m0/s1 |
| InChIKey | XCQBRYOSPVXIEL-RVYFUCBMSA-N |
| XLogP | 3.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|