C21H32O4 — CID 170031683
(3-hydroxy-7,13-dimethyl-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) methyl carbonate (PubChem CID 170031683) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (3-hydroxy-7,13-dimethyl-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) methyl carbonate.
| Compound Name | (3-hydroxy-7,13-dimethyl-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) methyl carbonate |
|---|---|
| PubChem CID | 170031683 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (3-hydroxy-7,13-dimethyl-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) methyl carbonate |
| SMILES | COC(=O)OC1CCC2C3C(C)CC4=CC(O)CCC4C3CCC12C |
| InChI | InChI=1S/C21H32O4/c1-12-10-13-11-14(22)4-5-15(13)16-8-9-21(2)17(19(12)16)6-7-18(21)25-20(23)24-3/h11-12,14-19,22H,4-10H2,1-3H3 |
| InChIKey | WSNVRXORXDWQOS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|