C20H31NO2 — CID 91090812
[(7R,8R,9S,10R,13S,14R,17R)-7,13-dimethyl-3-nitroso-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methanol (PubChem CID 91090812) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is [(7R,8R,9S,10R,13S,14R,17R)-7,13-dimethyl-3-nitroso-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methanol.
| Compound Name | [(7R,8R,9S,10R,13S,14R,17R)-7,13-dimethyl-3-nitroso-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methanol |
|---|---|
| PubChem CID | 91090812 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | [(7R,8R,9S,10R,13S,14R,17R)-7,13-dimethyl-3-nitroso-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methanol |
| SMILES | C[C@@H]1CC2=CC(N=O)CC[C@@H]2[C@H]2CC[C@]3(C)[C@H](CO)CC[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C20H31NO2/c1-12-9-13-10-15(21-23)4-5-16(13)17-7-8-20(2)14(11-22)3-6-18(20)19(12)17/h10,12,14-19,22H,3-9,11H2,1-2H3/t12-,14+,15?,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | YPSGOSBQPGBSTI-ZJFAHCKZSA-N |
| XLogP | 4.55 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|