C20H28O4 — CID 11290505
[(3R,8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-3,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] methyl carbonate (PubChem CID 11290505) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(3R,8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-3,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] methyl carbonate.
| Compound Name | [(3R,8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-3,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] methyl carbonate |
|---|---|
| PubChem CID | 11290505 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(3R,8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-3,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@H](O)C=CC4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H28O4/c1-20-10-9-15-14-6-4-13(21)11-12(14)3-5-16(15)17(20)7-8-18(20)24-19(22)23-2/h4,6,11,13-18,21H,3,5,7-10H2,1-2H3/t13-,14?,15-,16-,17+,18+,20+/m1/s1 |
| InChIKey | NPISAJNLJXBNES-CCXBWELESA-N |
| XLogP | 3.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|