C21H30O4 — CID 11439411
[(5S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] methyl carbonate (PubChem CID 11439411) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(5S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] methyl carbonate.
| Compound Name | [(5S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] methyl carbonate |
|---|---|
| PubChem CID | 11439411 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [(5S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H30O4/c1-20-10-8-14(22)12-13(20)4-5-15-16-6-7-18(25-19(23)24-3)21(16,2)11-9-17(15)20/h8,10,13,15-18H,4-7,9,11-12H2,1-3H3/t13-,15-,16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | HOBCBKZQBHOXPV-HGBUANBSSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |