C27H42O3 — CID 162942796
2-(10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-6-methylheptanoic acid (PubChem CID 162942796) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is 2-(10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-6-methylheptanoic acid.
| Compound Name | 2-(10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-6-methylheptanoic acid |
|---|---|
| PubChem CID | 162942796 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 2-(10,13-dimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-6-methylheptanoic acid |
| SMILES | CC(C)CCCC(C(=O)O)C1CCC2C3CCC4CC(=O)C=CC4(C)C3CCC12C |
| InChI | InChI=1S/C27H42O3/c1-17(2)6-5-7-21(25(29)30)23-11-10-22-20-9-8-18-16-19(28)12-14-26(18,3)24(20)13-15-27(22,23)4/h12,14,17-18,20-24H,5-11,13,15-16H2,1-4H3,(H,29,30) |
| InChIKey | YITVIWSRZUFONA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |