C26H34O4 — CID 11373238
[(3S,8R,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] phenyl carbonate (PubChem CID 11373238) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] phenyl carbonate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] phenyl carbonate |
|---|---|
| PubChem CID | 11373238 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] phenyl carbonate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2OC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H34O4/c1-25-14-12-18(27)16-17(25)8-9-20-21-10-11-23(26(21,2)15-13-22(20)25)30-24(28)29-19-6-4-3-5-7-19/h3-7,16,18,20-23,27H,8-15H2,1-2H3/t18-,20-,21-,22-,23-,25-,26-/m0/s1 |
| InChIKey | VETUKWPMQDAXNW-LVYWIKMTSA-N |
| XLogP | 5.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|