C25H40O4 — CID 11246706
butyl [(3R,8R,9S,10R,13S,14S,17S)-3-methoxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] carbonate (PubChem CID 11246706) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is butyl [(3R,8R,9S,10R,13S,14S,17S)-3-methoxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] carbonate.
| Compound Name | butyl [(3R,8R,9S,10R,13S,14S,17S)-3-methoxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] carbonate |
|---|---|
| PubChem CID | 11246706 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | butyl [(3R,8R,9S,10R,13S,14S,17S)-3-methoxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] carbonate |
| SMILES | CCCCOC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@H](OC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H40O4/c1-5-6-15-28-23(26)29-22-10-9-20-19-8-7-17-16-18(27-4)11-13-24(17,2)21(19)12-14-25(20,22)3/h16,18-22H,5-15H2,1-4H3/t18-,19+,20+,21+,22+,24+,25+/m1/s1 |
| InChIKey | QCPXJKWVYRLMLG-BXZPNGIOSA-N |
| XLogP | 6.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|