C23H32O4 — CID 2825523
(10,13-dimethyl-2-methylidene-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) ethyl carbonate (PubChem CID 2825523) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (10,13-dimethyl-2-methylidene-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) ethyl carbonate.
| Compound Name | (10,13-dimethyl-2-methylidene-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) ethyl carbonate |
|---|---|
| PubChem CID | 2825523 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (10,13-dimethyl-2-methylidene-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) ethyl carbonate |
| SMILES | C=C1CC2(C)C(=CC1=O)CCC1C2CCC2(C)C(OC(=O)OCC)CCC12 |
| InChI | InChI=1S/C23H32O4/c1-5-26-21(25)27-20-9-8-17-16-7-6-15-12-19(24)14(2)13-23(15,4)18(16)10-11-22(17,20)3/h12,16-18,20H,2,5-11,13H2,1,3-4H3 |
| InChIKey | NZFZLRHKJCFBJO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|