C24H38O4 — CID 11188463
[(3S,8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] ethyl carbonate (PubChem CID 11188463) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] ethyl carbonate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] ethyl carbonate |
|---|---|
| PubChem CID | 11188463 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@@H](OCC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H38O4/c1-5-26-17-11-13-23(3)16(15-17)7-8-18-19-9-10-21(28-22(25)27-6-2)24(19,4)14-12-20(18)23/h15,17-21H,5-14H2,1-4H3/t17-,18-,19-,20-,21-,23-,24-/m0/s1 |
| InChIKey | NZLFYVRAXVJVRI-DJKVCXMVSA-N |
| XLogP | 5.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|