C25H40O3 — CID 142223324
tert-butyl (10,13,17-trimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) carbonate (PubChem CID 142223324) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is tert-butyl (10,13,17-trimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) carbonate.
| Compound Name | tert-butyl (10,13,17-trimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) carbonate |
|---|---|
| PubChem CID | 142223324 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | tert-butyl (10,13,17-trimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) carbonate |
| SMILES | CC1CCC2C3CCC4=CC(OC(=O)OC(C)(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H40O3/c1-16-7-10-20-19-9-8-17-15-18(27-22(26)28-23(2,3)4)11-13-25(17,6)21(19)12-14-24(16,20)5/h15-16,18-21H,7-14H2,1-6H3 |
| InChIKey | VRXVSVZXYIKAEF-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|