C26H40ClNO3 — CID 88871628
[(3S,10R,13S,17S)-17-acetyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-(chloroamino)-3-methylbutanoate (PubChem CID 88871628) has the molecular formula C26H40ClNO3 and a molecular weight of 450.06 g/mol. Its IUPAC name is [(3S,10R,13S,17S)-17-acetyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-(chloroamino)-3-methylbutanoate.
| Compound Name | [(3S,10R,13S,17S)-17-acetyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-(chloroamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 88871628 |
| Molecular Formula | C26H40ClNO3 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | [(3S,10R,13S,17S)-17-acetyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-(chloroamino)-3-methylbutanoate |
| SMILES | CC(=O)[C@H]1CCC2C3CCC4=C[C@@H](OC(=O)[C@@H](NCl)C(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H40ClNO3/c1-15(2)23(28-27)24(30)31-18-10-12-25(4)17(14-18)6-7-19-21-9-8-20(16(3)29)26(21,5)13-11-22(19)25/h14-15,18-23,28H,6-13H2,1-5H3/t18-,19?,20+,21?,22?,23-,25-,26+/m0/s1 |
| InChIKey | LNBRQKMGGMAKQG-AEZVJGEGSA-N |
| XLogP | 5.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|