C31H43NO3 — CID 102018215
[(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[[(2R)-1-phenylpropan-2-yl]carbamoyl]-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 102018215) has the molecular formula C31H43NO3 and a molecular weight of 477.69 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[[(2R)-1-phenylpropan-2-yl]carbamoyl]-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[[(2R)-1-phenylpropan-2-yl]carbamoyl]-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 102018215 |
| Molecular Formula | C31H43NO3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[[(2R)-1-phenylpropan-2-yl]carbamoyl]-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C2CC[C@H]3[C@@H]4CC[C@H](C(=O)N[C@H](C)Cc5ccccc5)[C@@]4(C)CC[C@@H]3[C@@]2(C)CC1 |
| InChI | InChI=1S/C31H43NO3/c1-20(18-22-8-6-5-7-9-22)32-29(34)28-13-12-26-25-11-10-23-19-24(35-21(2)33)14-16-30(23,3)27(25)15-17-31(26,28)4/h5-9,19-20,24-28H,10-18H2,1-4H3,(H,32,34)/t20-,24+,25+,26+,27+,28-,30+,31+/m1/s1 |
| InChIKey | LRBJVLNGPCHEOH-MAPNOPJHSA-N |
| XLogP | 6.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|