C31H42O3S — CID 101234986
[(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2R)-1-phenylpropan-2-yl]sulfanylcarbonyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 101234986) has the molecular formula C31H42O3S and a molecular weight of 494.74 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2R)-1-phenylpropan-2-yl]sulfanylcarbonyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2R)-1-phenylpropan-2-yl]sulfanylcarbonyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 101234986 |
| Molecular Formula | C31H42O3S |
| Molecular Weight | 494.74 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2R)-1-phenylpropan-2-yl]sulfanylcarbonyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(=O)S[C@H](C)Cc5ccccc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H42O3S/c1-20(18-22-8-6-5-7-9-22)35-29(33)28-13-12-26-25-11-10-23-19-24(34-21(2)32)14-16-30(23,3)27(25)15-17-31(26,28)4/h5-10,20,24-28H,11-19H2,1-4H3/t20-,24+,25+,26+,27+,28-,30+,31+/m1/s1 |
| InChIKey | QKALUCZSWVAWSF-MAPNOPJHSA-N |
| XLogP | 7.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|