C28H38O2 — CID 129162808
1-[(3S,13S,17S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 129162808) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is 1-[(3S,13S,17S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,13S,17S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 129162808 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 1-[(3S,13S,17S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CCC2C3CC=C4C[C@@H](OCc5ccccc5)CCC4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H38O2/c1-19(29)24-11-12-25-23-10-9-21-17-22(30-18-20-7-5-4-6-8-20)13-15-27(21,2)26(23)14-16-28(24,25)3/h4-9,22-26H,10-18H2,1-3H3/t22-,23?,24+,25?,26?,27?,28+/m0/s1 |
| InChIKey | SIJCZMVIAPDAIT-VGIHXSNHSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|