C29H40O2 — CID 118424283
1-[(3S,10R,13S,17S)-10,13-dimethyl-3-[(4-methylphenyl)methoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 118424283) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is 1-[(3S,10R,13S,17S)-10,13-dimethyl-3-[(4-methylphenyl)methoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,10R,13S,17S)-10,13-dimethyl-3-[(4-methylphenyl)methoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 118424283 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | 1-[(3S,10R,13S,17S)-10,13-dimethyl-3-[(4-methylphenyl)methoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CCC2C3CC=C4C[C@@H](OCc5ccc(C)cc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H40O2/c1-19-5-7-21(8-6-19)18-31-23-13-15-28(3)22(17-23)9-10-24-26-12-11-25(20(2)30)29(26,4)16-14-27(24)28/h5-9,23-27H,10-18H2,1-4H3/t23-,24?,25+,26?,27?,28-,29+/m0/s1 |
| InChIKey | DVZGYKNYWKDQQR-PYIKZNRKSA-N |
| XLogP | 7.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|