C28H37BrO2 — CID 18649300
1-[(3S,7S,8S,9S,10R,13S,14S,17S)-7-bromo-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 18649300) has the molecular formula C28H37BrO2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 1-[(3S,7S,8S,9S,10R,13S,14S,17S)-7-bromo-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,7S,8S,9S,10R,13S,14S,17S)-7-bromo-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 18649300 |
| Molecular Formula | C28H37BrO2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 1-[(3S,7S,8S,9S,10R,13S,14S,17S)-7-bromo-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3[C@H](Br)C=C4C[C@@H](OCc5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H37BrO2/c1-18(30)22-9-10-23-26-24(12-14-28(22,23)3)27(2)13-11-21(15-20(27)16-25(26)29)31-17-19-7-5-4-6-8-19/h4-8,16,21-26H,9-15,17H2,1-3H3/t21-,22+,23-,24-,25+,26-,27-,28+/m0/s1 |
| InChIKey | FJQFCLYUHSSONY-PXGVPZTKSA-N |
| XLogP | 7.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|