C29H44O6 — CID 169432726
methyl 5-[[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]pentanoate (PubChem CID 169432726) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is methyl 5-[[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]pentanoate.
| Compound Name | methyl 5-[[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]pentanoate |
|---|---|
| PubChem CID | 169432726 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | methyl 5-[[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]pentanoate |
| SMILES | COC(=O)CCCCOC1C=C2C[C@@H](OC(C)=O)CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H](C(C)=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C29H44O6/c1-18(30)22-9-10-23-27-24(12-14-29(22,23)4)28(3)13-11-21(35-19(2)31)16-20(28)17-25(27)34-15-7-6-8-26(32)33-5/h17,21-25,27H,6-16H2,1-5H3/t21-,22+,23-,24-,25?,27-,28-,29+/m0/s1 |
| InChIKey | DGVHWZDPBPZPAB-DBKVNEPJSA-N |
| XLogP | 5.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|