C36H52O4 — CID 125031914
[(3R,7S,8S,9S,10S,13R,14R,17S)-3-acetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl] benzoate (PubChem CID 125031914) has the molecular formula C36H52O4 and a molecular weight of 548.81 g/mol. Its IUPAC name is [(3R,7S,8S,9S,10S,13R,14R,17S)-3-acetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl] benzoate.
| Compound Name | [(3R,7S,8S,9S,10S,13R,14R,17S)-3-acetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl] benzoate |
|---|---|
| PubChem CID | 125031914 |
| Molecular Formula | C36H52O4 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | [(3R,7S,8S,9S,10S,13R,14R,17S)-3-acetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C(=C[C@@H](OC(=O)c3ccccc3)[C@H]3[C@H]4CC[C@@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C36H52O4/c1-23(2)11-10-12-24(3)29-15-16-30-33-31(18-20-36(29,30)6)35(5)19-17-28(39-25(4)37)21-27(35)22-32(33)40-34(38)26-13-8-7-9-14-26/h7-9,13-14,22-24,28-33H,10-12,15-21H2,1-6H3/t24-,28-,29+,30-,31+,32-,33+,35-,36-/m1/s1 |
| InChIKey | SUEFRYOSRYPUAD-BIMAZTJHSA-N |
| XLogP | 8.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|