C36H54O3 — CID 4307655
[7-ethoxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 4307655) has the molecular formula C36H54O3 and a molecular weight of 534.83 g/mol. Its IUPAC name is [7-ethoxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [7-ethoxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 4307655 |
| Molecular Formula | C36H54O3 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | [7-ethoxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CCOC1C=C2CC(OC(=O)c3ccccc3)CCC2(C)C2CCC3(C)C(C(C)CCCC(C)C)CCC3C12 |
| InChI | InChI=1S/C36H54O3/c1-7-38-32-23-27-22-28(39-34(37)26-14-9-8-10-15-26)18-20-35(27,5)31-19-21-36(6)29(16-17-30(36)33(31)32)25(4)13-11-12-24(2)3/h8-10,14-15,23-25,28-33H,7,11-13,16-22H2,1-6H3 |
| InChIKey | YOOZNRNISMKWHV-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|