C41H58O2 — CID 99575635
(3S,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,7-bis(phenylmethoxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 99575635) has the molecular formula C41H58O2 and a molecular weight of 582.91 g/mol. Its IUPAC name is (3S,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,7-bis(phenylmethoxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,7-bis(phenylmethoxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 99575635 |
| Molecular Formula | C41H58O2 |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 582.44 |
| IUPAC Name | (3S,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,7-bis(phenylmethoxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](OCc4ccccc4)C=C4C[C@@H](OCc5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C41H58O2/c1-29(2)13-12-14-30(3)35-19-20-36-39-37(22-24-41(35,36)5)40(4)23-21-34(42-27-31-15-8-6-9-16-31)25-33(40)26-38(39)43-28-32-17-10-7-11-18-32/h6-11,15-18,26,29-30,34-39H,12-14,19-25,27-28H2,1-5H3/t30-,34+,35-,36+,37+,38-,39+,40+,41-/m1/s1 |
| InChIKey | JLPPIWFQQUFNCN-PVXFSZEVSA-N |
| XLogP | 10.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|