C39H59NO2 — CID 99600564
[(3R,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-piperidin-1-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 99600564) has the molecular formula C39H59NO2 and a molecular weight of 573.91 g/mol. Its IUPAC name is [(3R,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-piperidin-1-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3R,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-piperidin-1-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 99600564 |
| Molecular Formula | C39H59NO2 |
| Molecular Weight | 573.91 g/mol |
| Exact Mass | 573.45 |
| IUPAC Name | [(3R,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-piperidin-1-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(C)CCC[C@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](N4CCCCC4)C=C4C[C@H](OC(=O)c5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C39H59NO2/c1-27(2)13-12-14-28(3)32-17-18-33-36-34(20-22-39(32,33)5)38(4)21-19-31(42-37(41)29-15-8-6-9-16-29)25-30(38)26-35(36)40-23-10-7-11-24-40/h6,8-9,15-16,26-28,31-36H,7,10-14,17-25H2,1-5H3/t28-,31+,32+,33-,34-,35+,36-,38-,39+/m0/s1 |
| InChIKey | XSWCEFIPJIPPPW-CZMQSFDCSA-N |
| XLogP | 9.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.91 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|