C37H61NO2 — CID 158498256
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate;ethane;methanamine (PubChem CID 158498256) has the molecular formula C37H61NO2 and a molecular weight of 551.90 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate;ethane;methanamine.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate;ethane;methanamine |
|---|---|
| PubChem CID | 158498256 |
| Molecular Formula | C37H61NO2 |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 551.47 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate;ethane;methanamine |
| SMILES | CC.CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)c5ccccc5)CCC4(C)C3CCC12C.CN |
| InChI | InChI=1S/C34H50O2.C2H6.CH5N/c1-23(2)10-9-11-24(3)29-16-17-30-28-15-14-26-22-27(36-32(35)25-12-7-6-8-13-25)18-20-33(26,4)31(28)19-21-34(29,30)5;2*1-2/h6-8,12-14,23-24,27-31H,9-11,15-22H2,1-5H3;1-2H3;2H2,1H3 |
| InChIKey | HJOGDBKYNASFJQ-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|