C36H54O3 — CID 11885700
[(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-phenoxypropanoate (PubChem CID 11885700) has the molecular formula C36H54O3 and a molecular weight of 534.83 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-phenoxypropanoate.
| Compound Name | [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-phenoxypropanoate |
|---|---|
| PubChem CID | 11885700 |
| Molecular Formula | C36H54O3 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-phenoxypropanoate |
| SMILES | CC(C)CCC[C@H](C)[C@H]1CC[C@H]2[C@H]3CC=C4C[C@@H](OC(=O)[C@@H](C)Oc5ccccc5)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C36H54O3/c1-24(2)11-10-12-25(3)31-17-18-32-30-16-15-27-23-29(19-21-35(27,5)33(30)20-22-36(31,32)6)39-34(37)26(4)38-28-13-8-7-9-14-28/h7-9,13-15,24-26,29-33H,10-12,16-23H2,1-6H3/t25-,26+,29-,30+,31+,32-,33+,35-,36+/m0/s1 |
| InChIKey | AGJAOGVRZBWZKY-HQZFQSJXSA-N |
| XLogP | 9.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|