C37H54O4 — CID 11757586
[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-acetyloxy-2-phenylacetate (PubChem CID 11757586) has the molecular formula C37H54O4 and a molecular weight of 562.84 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 11757586 |
| Molecular Formula | C37H54O4 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 562.40 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-acetyloxy-2-phenylacetate |
| SMILES | CC(=O)O[C@H](C(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1)c1ccccc1 |
| InChI | InChI=1S/C37H54O4/c1-24(2)11-10-12-25(3)31-17-18-32-30-16-15-28-23-29(19-21-36(28,5)33(30)20-22-37(31,32)6)41-35(39)34(40-26(4)38)27-13-8-7-9-14-27/h7-9,13-15,24-25,29-34H,10-12,16-23H2,1-6H3/t25-,29-,30+,31-,32+,33+,34+,36+,37-/m1/s1 |
| InChIKey | GCOLRXMZARSZJK-QLJYRRPBSA-N |
| XLogP | 9.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|