C34H49ClO2 — CID 124897689
[(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-chlorobenzoate (PubChem CID 124897689) has the molecular formula C34H49ClO2 and a molecular weight of 525.22 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-chlorobenzoate.
| Compound Name | [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 124897689 |
| Molecular Formula | C34H49ClO2 |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-chlorobenzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@H]3CC=C4C[C@@H](OC(=O)c5cccc(Cl)c5)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C34H49ClO2/c1-22(2)8-6-9-23(3)29-14-15-30-28-13-12-25-21-27(37-32(36)24-10-7-11-26(35)20-24)16-18-33(25,4)31(28)17-19-34(29,30)5/h7,10-12,20,22-23,27-31H,6,8-9,13-19,21H2,1-5H3/t23-,27+,28-,29+,30-,31-,33+,34-/m1/s1 |
| InChIKey | QRDQXSNWNATDQX-DUTSDEEBSA-N |
| XLogP | 9.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|