C34H50NO4- — CID 163145811
[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[hydroxy(oxido)amino]benzoate (PubChem CID 163145811) has the molecular formula C34H50NO4- and a molecular weight of 536.78 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[hydroxy(oxido)amino]benzoate.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[hydroxy(oxido)amino]benzoate |
|---|---|
| PubChem CID | 163145811 |
| Molecular Formula | C34H50NO4- |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[hydroxy(oxido)amino]benzoate |
| SMILES | CC(C)CCC[C@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](OC(=O)c5cccc(N([O-])O)c5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H50NO4/c1-22(2)8-6-9-23(3)29-14-15-30-28-13-12-25-21-27(16-18-33(25,4)31(28)17-19-34(29,30)5)39-32(36)24-10-7-11-26(20-24)35(37)38/h7,10-12,20,22-23,27-31,37H,6,8-9,13-19,21H2,1-5H3/q-1/t23-,27+,28-,29+,30-,31-,33-,34+/m0/s1 |
| InChIKey | LGVATSZEIZVTBO-MOTKLJEASA-N |
| XLogP | 8.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|