C35H56N2O2 — CID 144519897
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate;methane (PubChem CID 144519897) has the molecular formula C35H56N2O2 and a molecular weight of 536.85 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate;methane.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate;methane |
|---|---|
| PubChem CID | 144519897 |
| Molecular Formula | C35H56N2O2 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 536.43 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate;methane |
| SMILES | C.CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)c5cc(N)cc(N)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C34H52N2O2.CH4/c1-21(2)7-6-8-22(3)29-11-12-30-28-10-9-24-19-27(38-32(37)23-17-25(35)20-26(36)18-23)13-15-33(24,4)31(28)14-16-34(29,30)5;/h9,17-18,20-22,27-31H,6-8,10-16,19,35-36H2,1-5H3;1H4 |
| InChIKey | HRZRNAKHSCNWCP-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|