C38H62O3 — CID 157441584
[(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-ethoxybenzoate;methane (PubChem CID 157441584) has the molecular formula C38H62O3 and a molecular weight of 566.91 g/mol. Its IUPAC name is [(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-ethoxybenzoate;methane.
| Compound Name | [(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-ethoxybenzoate;methane |
|---|---|
| PubChem CID | 157441584 |
| Molecular Formula | C38H62O3 |
| Molecular Weight | 566.91 g/mol |
| Exact Mass | 566.47 |
| IUPAC Name | [(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-ethoxybenzoate;methane |
| SMILES | C.C.CCOc1ccc(C(=O)OC2CC[C@@]3(C)C(=CCC4C5CCC(C(C)CCCC(C)C)[C@@]5(C)CCC43)C2)cc1 |
| InChI | InChI=1S/C36H54O3.2CH4/c1-7-38-28-14-11-26(12-15-28)34(37)39-29-19-21-35(5)27(23-29)13-16-30-32-18-17-31(25(4)10-8-9-24(2)3)36(32,6)22-20-33(30)35;;/h11-15,24-25,29-33H,7-10,16-23H2,1-6H3;2*1H4/t25?,29?,30?,31?,32?,33?,35-,36+;;/m0../s1 |
| InChIKey | BRSWIPRORNGMDZ-CCJLQXKKSA-N |
| XLogP | 10.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.91 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|