C44H70O3 — CID 99568094
[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-decoxybenzoate (PubChem CID 99568094) has the molecular formula C44H70O3 and a molecular weight of 647.04 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-decoxybenzoate.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 99568094 |
| Molecular Formula | C44H70O3 |
| Molecular Weight | 647.04 g/mol |
| Exact Mass | 646.53 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)O[C@@H]2CC[C@@]3(C)C(=CC[C@H]4[C@@H]5CC[C@H]([C@@H](C)CCCC(C)C)[C@@]5(C)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C44H70O3/c1-7-8-9-10-11-12-13-14-30-46-36-21-18-34(19-22-36)42(45)47-37-26-28-43(5)35(31-37)20-23-38-40-25-24-39(33(4)17-15-16-32(2)3)44(40,6)29-27-41(38)43/h18-22,32-33,37-41H,7-17,23-31H2,1-6H3/t33-,37+,38-,39+,40-,41-,43-,44+/m0/s1 |
| InChIKey | UNNDCGCBIWSYSW-AQFFQWHPSA-N |
| XLogP | 12.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.04 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|