C43H64O5 — CID 126549653
[(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 126549653) has the molecular formula C43H64O5 and a molecular weight of 660.98 g/mol. Its IUPAC name is [(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 126549653 |
| Molecular Formula | C43H64O5 |
| Molecular Weight | 660.98 g/mol |
| Exact Mass | 660.48 |
| IUPAC Name | [(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)O[C@H]2CC[C@@]3(C)C(=CCC4C5CCC(C(C)CCCC(C)C)[C@@]5(C)CCC43)C2)cc1 |
| InChI | InChI=1S/C43H64O5/c1-7-40(44)47-28-11-9-8-10-27-46-34-18-15-32(16-19-34)41(45)48-35-23-25-42(5)33(29-35)17-20-36-38-22-21-37(31(4)14-12-13-30(2)3)43(38,6)26-24-39(36)42/h7,15-19,30-31,35-39H,1,8-14,20-29H2,2-6H3/t31?,35-,36?,37?,38?,39?,42-,43+/m0/s1 |
| InChIKey | XQHGSDQVLKQRNZ-XBWAUWEASA-N |
| XLogP | 10.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.98 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|