C35H58O3 — CID 118010757
5-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]pentyl prop-2-enoate (PubChem CID 118010757) has the molecular formula C35H58O3 and a molecular weight of 526.85 g/mol. Its IUPAC name is 5-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]pentyl prop-2-enoate.
| Compound Name | 5-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 118010757 |
| Molecular Formula | C35H58O3 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.44 |
| IUPAC Name | 5-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOC1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C35H58O3/c1-7-33(36)38-23-10-8-9-22-37-28-18-20-34(5)27(24-28)14-15-29-31-17-16-30(26(4)13-11-12-25(2)3)35(31,6)21-19-32(29)34/h7,14,25-26,28-32H,1,8-13,15-24H2,2-6H3/t26-,28?,29?,30-,31?,32?,34+,35-/m1/s1 |
| InChIKey | KZSSZCVBGSFUMA-GRHZLFEWSA-N |
| XLogP | 9.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|