C37H54N2O4 — CID 118403181
4-O-(3,5-diaminophenyl) 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-but-2-enedioate (PubChem CID 118403181) has the molecular formula C37H54N2O4 and a molecular weight of 590.85 g/mol. Its IUPAC name is 4-O-(3,5-diaminophenyl) 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-but-2-enedioate.
| Compound Name | 4-O-(3,5-diaminophenyl) 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 118403181 |
| Molecular Formula | C37H54N2O4 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.41 |
| IUPAC Name | 4-O-(3,5-diaminophenyl) 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-but-2-enedioate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)/C=C/C(=O)Oc5cc(N)cc(N)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C37H54N2O4/c1-23(2)7-6-8-24(3)31-11-12-32-30-10-9-25-19-28(15-17-36(25,4)33(30)16-18-37(31,32)5)42-34(40)13-14-35(41)43-29-21-26(38)20-27(39)22-29/h9,13-14,20-24,28,30-33H,6-8,10-12,15-19,38-39H2,1-5H3/b14-13+ |
| InChIKey | HNWJVIZLKKLTOQ-BUHFOSPRSA-N |
| XLogP | 8.27 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|