C39H50F6O4 — CID 24899260
4-O-[3,5-bis(trifluoromethyl)phenyl] 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-but-2-enedioate (PubChem CID 24899260) has the molecular formula C39H50F6O4 and a molecular weight of 696.81 g/mol. Its IUPAC name is 4-O-[3,5-bis(trifluoromethyl)phenyl] 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-but-2-enedioate.
| Compound Name | 4-O-[3,5-bis(trifluoromethyl)phenyl] 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 24899260 |
| Molecular Formula | C39H50F6O4 |
| Molecular Weight | 696.81 g/mol |
| Exact Mass | 696.36 |
| IUPAC Name | 4-O-[3,5-bis(trifluoromethyl)phenyl] 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-but-2-enedioate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)/C=C/C(=O)Oc5cc(C(F)(F)F)cc(C(F)(F)F)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C39H50F6O4/c1-23(2)7-6-8-24(3)31-11-12-32-30-10-9-25-20-28(15-17-36(25,4)33(30)16-18-37(31,32)5)48-34(46)13-14-35(47)49-29-21-26(38(40,41)42)19-27(22-29)39(43,44)45/h9,13-14,19,21-24,28,30-33H,6-8,10-12,15-18,20H2,1-5H3/b14-13+ |
| InChIKey | ROBOGVBVJPDULI-BUHFOSPRSA-N |
| XLogP | 11.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.81 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|