C40H54F6O4 — CID 24899261
5-O-[3,5-bis(trifluoromethyl)phenyl] 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanedioate (PubChem CID 24899261) has the molecular formula C40H54F6O4 and a molecular weight of 712.86 g/mol. Its IUPAC name is 5-O-[3,5-bis(trifluoromethyl)phenyl] 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanedioate.
| Compound Name | 5-O-[3,5-bis(trifluoromethyl)phenyl] 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanedioate |
|---|---|
| PubChem CID | 24899261 |
| Molecular Formula | C40H54F6O4 |
| Molecular Weight | 712.86 g/mol |
| Exact Mass | 712.39 |
| IUPAC Name | 5-O-[3,5-bis(trifluoromethyl)phenyl] 1-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanedioate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCCC(=O)Oc5cc(C(F)(F)F)cc(C(F)(F)F)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C40H54F6O4/c1-24(2)8-6-9-25(3)32-14-15-33-31-13-12-26-21-29(16-18-37(26,4)34(31)17-19-38(32,33)5)49-35(47)10-7-11-36(48)50-30-22-27(39(41,42)43)20-28(23-30)40(44,45)46/h12,20,22-25,29,31-34H,6-11,13-19,21H2,1-5H3 |
| InChIKey | KBGWZLKQWQYWDA-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.86 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|