C44H60O4 — CID 101395090
1-O-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-O-(4-phenylphenyl) pentanedioate (PubChem CID 101395090) has the molecular formula C44H60O4 and a molecular weight of 652.96 g/mol. Its IUPAC name is 1-O-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-O-(4-phenylphenyl) pentanedioate.
| Compound Name | 1-O-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-O-(4-phenylphenyl) pentanedioate |
|---|---|
| PubChem CID | 101395090 |
| Molecular Formula | C44H60O4 |
| Molecular Weight | 652.96 g/mol |
| Exact Mass | 652.45 |
| IUPAC Name | 1-O-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-O-(4-phenylphenyl) pentanedioate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(OC(=O)CCCC(=O)Oc5ccc(-c6ccccc6)cc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C44H60O4/c1-30(2)11-9-12-31(3)38-23-24-39-37-22-19-34-29-36(25-27-43(34,4)40(37)26-28-44(38,39)5)48-42(46)16-10-15-41(45)47-35-20-17-33(18-21-35)32-13-7-6-8-14-32/h6-8,13-14,17-21,30-31,36-40H,9-12,15-16,22-29H2,1-5H3/t31-,36?,37+,38-,39+,40+,43+,44-/m1/s1 |
| InChIKey | HEAGDGUKVIVXBM-XGJNMMHQSA-N |
| XLogP | 11.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.96 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|