C37H56O5 — CID 58445479
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4,5-trimethoxybenzoate (PubChem CID 58445479) has the molecular formula C37H56O5 and a molecular weight of 580.85 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 58445479 |
| Molecular Formula | C37H56O5 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.41 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OC2CCC3(C)C(=CCC4C3CCC3(C)C(C(C)CCCC(C)C)CCC43)C2)cc(OC)c1OC |
| InChI | InChI=1S/C37H56O5/c1-23(2)10-9-11-24(3)29-14-15-30-28-13-12-26-22-27(16-18-36(26,4)31(28)17-19-37(29,30)5)42-35(38)25-20-32(39-6)34(41-8)33(21-25)40-7/h12,20-21,23-24,27-31H,9-11,13-19,22H2,1-8H3 |
| InChIKey | OPXTWKDSVZNRMZ-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|