C35H54N2O3 — CID 68816054
[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diamino-2-methoxybenzoate (PubChem CID 68816054) has the molecular formula C35H54N2O3 and a molecular weight of 550.83 g/mol. Its IUPAC name is [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diamino-2-methoxybenzoate.
| Compound Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diamino-2-methoxybenzoate |
|---|---|
| PubChem CID | 68816054 |
| Molecular Formula | C35H54N2O3 |
| Molecular Weight | 550.83 g/mol |
| Exact Mass | 550.41 |
| IUPAC Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diamino-2-methoxybenzoate |
| SMILES | COc1c(N)cc(N)cc1C(=O)OC1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C35H54N2O3/c1-21(2)8-7-9-22(3)28-12-13-29-26-11-10-23-18-25(14-16-34(23,4)30(26)15-17-35(28,29)5)40-33(38)27-19-24(36)20-31(37)32(27)39-6/h10,19-22,25-26,28-30H,7-9,11-18,36-37H2,1-6H3/t22-,25?,26?,28-,29?,30?,34+,35-/m1/s1 |
| InChIKey | XMGCGBZSTARMSJ-LTYQGQNKSA-N |
| XLogP | 8.43 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.83 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|