C36H54O4 — CID 99566728
[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,3-dimethoxybenzoate (PubChem CID 99566728) has the molecular formula C36H54O4 and a molecular weight of 550.82 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,3-dimethoxybenzoate.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 99566728 |
| Molecular Formula | C36H54O4 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)O[C@@H]2CC[C@@]3(C)C(=CC[C@H]4[C@@H]5CC[C@H]([C@@H](C)CCCC(C)C)[C@@]5(C)CC[C@@H]43)C2)c1OC |
| InChI | InChI=1S/C36H54O4/c1-23(2)10-8-11-24(3)29-16-17-30-27-15-14-25-22-26(18-20-35(25,4)31(27)19-21-36(29,30)5)40-34(37)28-12-9-13-32(38-6)33(28)39-7/h9,12-14,23-24,26-27,29-31H,8,10-11,15-22H2,1-7H3/t24-,26+,27-,29+,30-,31-,35-,36+/m0/s1 |
| InChIKey | YDKGIMKKCPTDLL-GKQPARGWSA-N |
| XLogP | 9.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|