C34H50ClNO2 — CID 11947000
[(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-chlorophenyl)carbamate (PubChem CID 11947000) has the molecular formula C34H50ClNO2 and a molecular weight of 540.23 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-chlorophenyl)carbamate.
| Compound Name | [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 11947000 |
| Molecular Formula | C34H50ClNO2 |
| Molecular Weight | 540.23 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-chlorophenyl)carbamate |
| SMILES | CC(C)CCC[C@H](C)[C@H]1CC[C@H]2[C@H]3CC=C4C[C@@H](OC(=O)Nc5cccc(Cl)c5)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C34H50ClNO2/c1-22(2)8-6-9-23(3)29-14-15-30-28-13-12-24-20-27(38-32(37)36-26-11-7-10-25(35)21-26)16-18-33(24,4)31(28)17-19-34(29,30)5/h7,10-12,21-23,27-31H,6,8-9,13-20H2,1-5H3,(H,36,37)/t23-,27-,28+,29+,30-,31+,33-,34+/m0/s1 |
| InChIKey | OQKBINPASXJKLA-UUBRMWGXSA-N |
| XLogP | 10.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.23 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|