C32H55NO5 — CID 112758562
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamate (PubChem CID 112758562) has the molecular formula C32H55NO5 and a molecular weight of 533.79 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 112758562 |
| Molecular Formula | C32H55NO5 |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.41 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NC(CO)(CO)CO)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H55NO5/c1-21(2)7-6-8-22(3)26-11-12-27-25-10-9-23-17-24(38-29(37)33-32(18-34,19-35)20-36)13-15-30(23,4)28(25)14-16-31(26,27)5/h9,21-22,24-28,34-36H,6-8,10-20H2,1-5H3,(H,33,37) |
| InChIKey | LCAHELMWRAYAAV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|