C23H35Br — CID 59761000
(3S,7S,8S,9S,10R,13S,14S,17R)-7-bromo-3,10,13-trimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 59761000) has the molecular formula C23H35Br and a molecular weight of 391.44 g/mol. Its IUPAC name is (3S,7S,8S,9S,10R,13S,14S,17R)-7-bromo-3,10,13-trimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,7S,8S,9S,10R,13S,14S,17R)-7-bromo-3,10,13-trimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 59761000 |
| Molecular Formula | C23H35Br |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (3S,7S,8S,9S,10R,13S,14S,17R)-7-bromo-3,10,13-trimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=C(C)[C@H]1CC[C@H]2[C@@H]3[C@H](Br)C=C4C[C@@H](C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H35Br/c1-14(2)17-6-7-18-21-19(9-11-23(17,18)5)22(4)10-8-15(3)12-16(22)13-20(21)24/h13,15,17-21H,1,6-12H2,2-5H3/t15-,17+,18-,19-,20+,21-,22-,23+/m0/s1 |
| InChIKey | NVDJIGNXGDNJKZ-PYWJFZRLSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|