C21H31IO2 — CID 57299875
1-[(8S,9S,10R,13S,14S,17S)-3-hydroxy-7-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 57299875) has the molecular formula C21H31IO2 and a molecular weight of 442.38 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13S,14S,17S)-3-hydroxy-7-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8S,9S,10R,13S,14S,17S)-3-hydroxy-7-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 57299875 |
| Molecular Formula | C21H31IO2 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[(8S,9S,10R,13S,14S,17S)-3-hydroxy-7-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3C(I)C=C4CC(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31IO2/c1-12(23)15-4-5-16-19-17(7-9-21(15,16)3)20(2)8-6-14(24)10-13(20)11-18(19)22/h11,14-19,24H,4-10H2,1-3H3/t14?,15-,16+,17+,18?,19+,20+,21-/m1/s1 |
| InChIKey | PYYAXCYCYDGRLC-PUNTUCFWSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|