C21H32O7S — CID 69348453
17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one;sulfuric acid (PubChem CID 69348453) has the molecular formula C21H32O7S and a molecular weight of 428.55 g/mol. Its IUPAC name is 17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one;sulfuric acid.
| Compound Name | 17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one;sulfuric acid |
|---|---|
| PubChem CID | 69348453 |
| Molecular Formula | C21H32O7S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one;sulfuric acid |
| SMILES | CC(=O)C1CCC2C3C(=O)C=C4CC(O)CCC4(C)C3CCC12C.O=S(=O)(O)O |
| InChI | InChI=1S/C21H30O3.H2O4S/c1-12(22)15-4-5-16-19-17(7-9-21(15,16)3)20(2)8-6-14(23)10-13(20)11-18(19)24;1-5(2,3)4/h11,14-17,19,23H,4-10H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | RJNVHUSHNVVHLP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|