C28H36O4 — CID 124916815
[(3S,8S,9R,10R,13R,14R,17S)-10,13-dimethyl-7-oxo-17-phenylmethoxy-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124916815) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(3S,8S,9R,10R,13R,14R,17S)-10,13-dimethyl-7-oxo-17-phenylmethoxy-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9R,10R,13R,14R,17S)-10,13-dimethyl-7-oxo-17-phenylmethoxy-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124916815 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(3S,8S,9R,10R,13R,14R,17S)-10,13-dimethyl-7-oxo-17-phenylmethoxy-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC(=O)[C@@H]3[C@H]4CC[C@H](OCc5ccccc5)[C@]4(C)CC[C@H]32)C1 |
| InChI | InChI=1S/C28H36O4/c1-18(29)32-21-11-13-27(2)20(15-21)16-24(30)26-22-9-10-25(28(22,3)14-12-23(26)27)31-17-19-7-5-4-6-8-19/h4-8,16,21-23,25-26H,9-15,17H2,1-3H3/t21-,22+,23+,25-,26+,27-,28+/m0/s1 |
| InChIKey | TUEREPUZRGDETH-LTWCPPSOSA-N |
| XLogP | 5.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |