C23H30O6 — CID 59742814
[(3S,8R,9S,10R,13S,14S)-16-acetyloxy-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 59742814) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-16-acetyloxy-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-16-acetyloxy-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 59742814 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-16-acetyloxy-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1C[C@H]2[C@@H]3C(=O)C=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C23H30O6/c1-12(24)28-15-5-7-22(3)14(9-15)10-18(26)20-16(22)6-8-23(4)17(20)11-19(21(23)27)29-13(2)25/h10,15-17,19-20H,5-9,11H2,1-4H3/t15-,16-,17-,19?,20+,22-,23-/m0/s1 |
| InChIKey | RYSQOTKTQGWIAR-PYQRENMNSA-N |
| XLogP | 3.17 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |