C35H44O4 — CID 90189029
1-[(8S,9S,10R,13S,14S,17S)-7-benzyl-3-hydroxy-3-[(4-hydroxyphenyl)methoxy]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 90189029) has the molecular formula C35H44O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13S,14S,17S)-7-benzyl-3-hydroxy-3-[(4-hydroxyphenyl)methoxy]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8S,9S,10R,13S,14S,17S)-7-benzyl-3-hydroxy-3-[(4-hydroxyphenyl)methoxy]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 90189029 |
| Molecular Formula | C35H44O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 1-[(8S,9S,10R,13S,14S,17S)-7-benzyl-3-hydroxy-3-[(4-hydroxyphenyl)methoxy]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3C(Cc4ccccc4)C=C4CC(O)(OCc5ccc(O)cc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H44O4/c1-23(36)29-13-14-30-32-26(19-24-7-5-4-6-8-24)20-27-21-35(38,39-22-25-9-11-28(37)12-10-25)18-17-33(27,2)31(32)15-16-34(29,30)3/h4-12,20,26,29-32,37-38H,13-19,21-22H2,1-3H3/t26?,29-,30+,31+,32+,33+,34-,35?/m1/s1 |
| InChIKey | AELUJXOSQRYDQU-IYUNDFQTSA-N |
| XLogP | 7.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|