C31H44O3 — CID 144634866
1-[(3S,10R,13S,17S)-7-ethyl-3-hydroxy-10,13-dimethyl-3-[(4-methylphenyl)methoxy]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 144634866) has the molecular formula C31H44O3 and a molecular weight of 464.69 g/mol. Its IUPAC name is 1-[(3S,10R,13S,17S)-7-ethyl-3-hydroxy-10,13-dimethyl-3-[(4-methylphenyl)methoxy]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,10R,13S,17S)-7-ethyl-3-hydroxy-10,13-dimethyl-3-[(4-methylphenyl)methoxy]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 144634866 |
| Molecular Formula | C31H44O3 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 1-[(3S,10R,13S,17S)-7-ethyl-3-hydroxy-10,13-dimethyl-3-[(4-methylphenyl)methoxy]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CCC1C=C2C[C@@](O)(OCc3ccc(C)cc3)CC[C@]2(C)C2CC[C@@]3(C)C(CC[C@@H]3C(C)=O)C12 |
| InChI | InChI=1S/C31H44O3/c1-6-23-17-24-18-31(33,34-19-22-9-7-20(2)8-10-22)16-15-29(24,4)27-13-14-30(5)25(21(3)32)11-12-26(30)28(23)27/h7-10,17,23,25-28,33H,6,11-16,18-19H2,1-5H3/t23?,25-,26?,27?,28?,29+,30-,31+/m1/s1 |
| InChIKey | QDGCHSSRTCFQDI-CKWKYWCHSA-N |
| XLogP | 7.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|