C31H42O4 — CID 140692520
1-[(3S,10R,13S,17S)-3-hydroxy-3-[(4-hydroxyphenyl)methoxy]-10,13-dimethyl-17-prop-2-enyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 140692520) has the molecular formula C31H42O4 and a molecular weight of 478.67 g/mol. Its IUPAC name is 1-[(3S,10R,13S,17S)-3-hydroxy-3-[(4-hydroxyphenyl)methoxy]-10,13-dimethyl-17-prop-2-enyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,10R,13S,17S)-3-hydroxy-3-[(4-hydroxyphenyl)methoxy]-10,13-dimethyl-17-prop-2-enyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 140692520 |
| Molecular Formula | C31H42O4 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 1-[(3S,10R,13S,17S)-3-hydroxy-3-[(4-hydroxyphenyl)methoxy]-10,13-dimethyl-17-prop-2-enyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C=CC[C@@]1(C(C)=O)CCC2C3CC=C4C[C@@](O)(OCc5ccc(O)cc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H42O4/c1-5-14-30(21(2)32)16-13-27-25-11-8-23-19-31(34,35-20-22-6-9-24(33)10-7-22)18-17-28(23,3)26(25)12-15-29(27,30)4/h5-10,25-27,33-34H,1,11-20H2,2-4H3/t25?,26?,27?,28-,29-,30-,31-/m0/s1 |
| InChIKey | VUUOMGKDNZKHKZ-GRZHLXLJSA-N |
| XLogP | 6.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|